C34H34F9NO4S — CID 144882181
N-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfinylcyclopentyl]formamide;4-methyloxane (PubChem CID 144882181) has the molecular formula C34H34F9NO4S and a molecular weight of 723.70 g/mol. Its IUPAC name is N-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfinylcyclopentyl]formamide;4-methyloxane.
| Compound Name | N-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfinylcyclopentyl]formamide;4-methyloxane |
|---|---|
| PubChem CID | 144882181 |
| Molecular Formula | C34H34F9NO4S |
| Molecular Weight | 723.70 g/mol |
| Exact Mass | 723.21 |
| IUPAC Name | N-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfinylcyclopentyl]formamide;4-methyloxane |
| SMILES | CC1CCOCC1.O=CNC1CCC(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C28H22F9NO3S.C6H12O/c29-19-8-10-21(11-9-19)42(40)25(13-12-20(14-25)38-16-39)17-4-6-18(7-5-17)26(27(32,33)34,28(35,36)37)41-15-22-23(30)2-1-3-24(22)31;1-6-2-4-7-5-3-6/h1-11,16,20H,12-15H2,(H,38,39);6H,2-5H2,1H3 |
| InChIKey | BSVYZKRUFYWCLJ-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.70 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|