C14H19BN2O6 — CID 144978189
(3R)-2-hydroxy-3-[[2-(2-methoxyethoxy)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxamide (PubChem CID 144978189) has the molecular formula C14H19BN2O6 and a molecular weight of 322.13 g/mol. Its IUPAC name is (3R)-2-hydroxy-3-[[2-(2-methoxyethoxy)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxamide.
| Compound Name | (3R)-2-hydroxy-3-[[2-(2-methoxyethoxy)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxamide |
|---|---|
| PubChem CID | 144978189 |
| Molecular Formula | C14H19BN2O6 |
| Molecular Weight | 322.13 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (3R)-2-hydroxy-3-[[2-(2-methoxyethoxy)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxamide |
| SMILES | COCCOCC(=O)N[C@H]1Cc2cccc(C(N)=O)c2OB1O |
| InChI | InChI=1S/C14H19BN2O6/c1-21-5-6-22-8-12(18)17-11-7-9-3-2-4-10(14(16)19)13(9)23-15(11)20/h2-4,11,20H,5-8H2,1H3,(H2,16,19)(H,17,18)/t11-/m0/s1 |
| InChIKey | JHWQERJFEXTLEW-NSHDSACASA-N |
| XLogP | -1.11 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.13 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|