C28H25N5O2S — CID 146459790
[2-[6-carbamimidoyl-1-(naphthalen-1-ylmethyl)indol-2-yl]-4,5,6,7-tetrahydro-1,3-benzothiazol-5-yl] carbamate (PubChem CID 146459790) has the molecular formula C28H25N5O2S and a molecular weight of 495.61 g/mol. Its IUPAC name is [2-[6-carbamimidoyl-1-(naphthalen-1-ylmethyl)indol-2-yl]-4,5,6,7-tetrahydro-1,3-benzothiazol-5-yl] carbamate.
| Compound Name | [2-[6-carbamimidoyl-1-(naphthalen-1-ylmethyl)indol-2-yl]-4,5,6,7-tetrahydro-1,3-benzothiazol-5-yl] carbamate |
|---|---|
| PubChem CID | 146459790 |
| Molecular Formula | C28H25N5O2S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | [2-[6-carbamimidoyl-1-(naphthalen-1-ylmethyl)indol-2-yl]-4,5,6,7-tetrahydro-1,3-benzothiazol-5-yl] carbamate |
| SMILES | [H]/N=C(\N)c1ccc2cc(-c3nc4c(s3)CCC(OC(N)=O)C4)n(Cc3cccc4ccccc34)c2c1 |
| InChI | InChI=1S/C28H25N5O2S/c29-26(30)18-9-8-17-12-24(27-32-22-14-20(35-28(31)34)10-11-25(22)36-27)33(23(17)13-18)15-19-6-3-5-16-4-1-2-7-21(16)19/h1-9,12-13,20H,10-11,14-15H2,(H3,29,30)(H2,31,34) |
| InChIKey | FNICMJKVWZDGNB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|