C16H18BN3O5 — CID 152922742
methyl (3R)-2-hydroxy-3-(3-imidazol-1-ylpropanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 152922742) has the molecular formula C16H18BN3O5 and a molecular weight of 343.15 g/mol. Its IUPAC name is methyl (3R)-2-hydroxy-3-(3-imidazol-1-ylpropanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | methyl (3R)-2-hydroxy-3-(3-imidazol-1-ylpropanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 152922742 |
| Molecular Formula | C16H18BN3O5 |
| Molecular Weight | 343.15 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | methyl (3R)-2-hydroxy-3-(3-imidazol-1-ylpropanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | COC(=O)c1cccc2c1OB(O)[C@@H](NC(=O)CCn1ccnc1)C2 |
| InChI | InChI=1S/C16H18BN3O5/c1-24-16(22)12-4-2-3-11-9-13(17(23)25-15(11)12)19-14(21)5-7-20-8-6-18-10-20/h2-4,6,8,10,13,23H,5,7,9H2,1H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | UJKMQCIXVZEJAX-ZDUSSCGKSA-N |
| XLogP | 0.20 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.15 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|