C14H21N5O6 — CID 155319443
2-amino-5-(carbamoylamino)pentanoic acid;carbamoyl 4-aminobenzoate (PubChem CID 155319443) has the molecular formula C14H21N5O6 and a molecular weight of 355.35 g/mol. Its IUPAC name is 2-amino-5-(carbamoylamino)pentanoic acid;carbamoyl 4-aminobenzoate.
| Compound Name | 2-amino-5-(carbamoylamino)pentanoic acid;carbamoyl 4-aminobenzoate |
|---|---|
| PubChem CID | 155319443 |
| Molecular Formula | C14H21N5O6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-amino-5-(carbamoylamino)pentanoic acid;carbamoyl 4-aminobenzoate |
| SMILES | NC(=O)NCCCC(N)C(=O)O.NC(=O)OC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C8H8N2O3.C6H13N3O3/c9-6-3-1-5(2-4-6)7(11)13-8(10)12;7-4(5(10)11)2-1-3-9-6(8)12/h1-4H,9H2,(H2,10,12);4H,1-3,7H2,(H,10,11)(H3,8,9,12) |
| InChIKey | JSHNELWLUVNULV-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 213.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|