C27H34ClO5P — CID 155575582
3-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenol (PubChem CID 155575582) has the molecular formula C27H34ClO5P and a molecular weight of 504.99 g/mol. Its IUPAC name is 3-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenol.
| Compound Name | 3-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenol |
|---|---|
| PubChem CID | 155575582 |
| Molecular Formula | C27H34ClO5P |
| Molecular Weight | 504.99 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 3-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenol |
| SMILES | CCCCCc1cc(O)c(C2C=C(C)CCC2)c(OP2(=O)OCCC(c3cccc(Cl)c3)O2)c1 |
| InChI | InChI=1S/C27H34ClO5P/c1-3-4-5-9-20-16-24(29)27(22-11-6-8-19(2)15-22)26(17-20)33-34(30)31-14-13-25(32-34)21-10-7-12-23(28)18-21/h7,10,12,15-18,22,25,29H,3-6,8-9,11,13-14H2,1-2H3 |
| InChIKey | RGQIRSGFCFIWTP-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.99 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|