About formyl chloride;nitrobenzene;hydrate
formyl chloride;nitrobenzene;hydrate (PubChem CID 158709717) has the molecular formula C7H8ClNO4
and a molecular weight of 205.60 g/mol. Its IUPAC name is formyl chloride;nitrobenzene;hydrate.
Molecular Properties
| Compound Name | formyl chloride;nitrobenzene;hydrate |
| PubChem CID | 158709717 |
| Molecular Formula | C7H8ClNO4 |
| Molecular Weight | 205.60 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | formyl chloride;nitrobenzene;hydrate |
| SMILES | O.O=CCl.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.CHClO.H2O/c8-7(9)6-4-2-1-3-5-6;2-1-3;/h1-5H;1H;1H2 |
| InChIKey | RSZBFLYVWDNJQX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 91.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.60 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze formyl chloride;nitrobenzene;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formyl chloride;nitrobenzene;hydrate?
The IUPAC name of formyl chloride;nitrobenzene;hydrate (CID 158709717) is formyl chloride;nitrobenzene;hydrate.
What is the SMILES notation for formyl chloride;nitrobenzene;hydrate?
The canonical SMILES for formyl chloride;nitrobenzene;hydrate is O.O=CCl.O=[N+]([O-])c1ccccc1.
What is the InChIKey of formyl chloride;nitrobenzene;hydrate?
The InChIKey is RSZBFLYVWDNJQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.CHClO.H2O/c8-7(9)6-4-2-1-3-5-6;2-1-3;/h1-5H;1H;1H2.
What are the key properties of formyl chloride;nitrobenzene;hydrate?
formyl chloride;nitrobenzene;hydrate has a molecular weight of 205.60 g/mol, XLogP of 1.19, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formyl chloride;nitrobenzene;hydrate is sourced from PubChem (CID 158709717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).