About nitrobenzene;1,2-thiazole
nitrobenzene;1,2-thiazole (PubChem CID 162228510) has the molecular formula C9H8N2O2S
and a molecular weight of 208.24 g/mol. Its IUPAC name is nitrobenzene;1,2-thiazole.
Molecular Properties
| Compound Name | nitrobenzene;1,2-thiazole |
| PubChem CID | 162228510 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | nitrobenzene;1,2-thiazole |
| SMILES | O=[N+]([O-])c1ccccc1.c1cnsc1 |
| InChI | InChI=1S/C6H5NO2.C3H3NS/c8-7(9)6-4-2-1-3-5-6;1-2-4-5-3-1/h1-5H;1-3H |
| InChIKey | ZVCADMKDLDUPIX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitrobenzene;1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrobenzene;1,2-thiazole?
The IUPAC name of nitrobenzene;1,2-thiazole (CID 162228510) is nitrobenzene;1,2-thiazole.
What is the SMILES notation for nitrobenzene;1,2-thiazole?
The canonical SMILES for nitrobenzene;1,2-thiazole is O=[N+]([O-])c1ccccc1.c1cnsc1.
What is the InChIKey of nitrobenzene;1,2-thiazole?
The InChIKey is ZVCADMKDLDUPIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.C3H3NS/c8-7(9)6-4-2-1-3-5-6;1-2-4-5-3-1/h1-5H;1-3H.
What are the key properties of nitrobenzene;1,2-thiazole?
nitrobenzene;1,2-thiazole has a molecular weight of 208.24 g/mol, XLogP of 2.74, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nitrobenzene;1,2-thiazole is sourced from PubChem (CID 162228510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).