About nitrobenzene;1,3-thiazole;zinc
nitrobenzene;1,3-thiazole;zinc (PubChem CID 175606702) has the molecular formula C9H8N2O2SZn
and a molecular weight of 273.63 g/mol. Its IUPAC name is nitrobenzene;1,3-thiazole;zinc.
Molecular Properties
| Compound Name | nitrobenzene;1,3-thiazole;zinc |
| PubChem CID | 175606702 |
| Molecular Formula | C9H8N2O2SZn |
| Molecular Weight | 273.63 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | nitrobenzene;1,3-thiazole;zinc |
| SMILES | O=[N+]([O-])c1ccccc1.[Zn].c1cscn1 |
| InChI | InChI=1S/C6H5NO2.C3H3NS.Zn/c8-7(9)6-4-2-1-3-5-6;1-2-5-3-4-1;/h1-5H;1-3H; |
| InChIKey | MWYZKLDLCCBPAD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.63 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitrobenzene;1,3-thiazole;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrobenzene;1,3-thiazole;zinc?
The IUPAC name of nitrobenzene;1,3-thiazole;zinc (CID 175606702) is nitrobenzene;1,3-thiazole;zinc.
What is the SMILES notation for nitrobenzene;1,3-thiazole;zinc?
The canonical SMILES for nitrobenzene;1,3-thiazole;zinc is O=[N+]([O-])c1ccccc1.[Zn].c1cscn1.
What is the InChIKey of nitrobenzene;1,3-thiazole;zinc?
The InChIKey is MWYZKLDLCCBPAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.C3H3NS.Zn/c8-7(9)6-4-2-1-3-5-6;1-2-5-3-4-1;/h1-5H;1-3H;.
What are the key properties of nitrobenzene;1,3-thiazole;zinc?
nitrobenzene;1,3-thiazole;zinc has a molecular weight of 273.63 g/mol, XLogP of 2.74, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nitrobenzene;1,3-thiazole;zinc is sourced from PubChem (CID 175606702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).