C38H56BN3O4 — CID 162445594
(3aR,6aR)-2-acetamido-N-tert-butyl-5-(dibenzylamino)-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalene-2-carboxamide (PubChem CID 162445594) has the molecular formula C38H56BN3O4 and a molecular weight of 629.70 g/mol. Its IUPAC name is (3aR,6aR)-2-acetamido-N-tert-butyl-5-(dibenzylamino)-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalene-2-carboxamide.
| Compound Name | (3aR,6aR)-2-acetamido-N-tert-butyl-5-(dibenzylamino)-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalene-2-carboxamide |
|---|---|
| PubChem CID | 162445594 |
| Molecular Formula | C38H56BN3O4 |
| Molecular Weight | 629.70 g/mol |
| Exact Mass | 629.44 |
| IUPAC Name | (3aR,6aR)-2-acetamido-N-tert-butyl-5-(dibenzylamino)-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalene-2-carboxamide |
| SMILES | CC(=O)NC1(C(=O)NC(C)(C)C)C[C@H]2CC(N(Cc3ccccc3)Cc3ccccc3)C[C@H]2C1CCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C38H56BN3O4/c1-27(43)40-38(34(44)41-35(2,3)4)24-30-22-31(42(25-28-16-11-9-12-17-28)26-29-18-13-10-14-19-29)23-32(30)33(38)20-15-21-39-45-36(5,6)37(7,8)46-39/h9-14,16-19,30-33H,15,20-26H2,1-8H3,(H,40,43)(H,41,44)/t30-,31?,32-,33?,38?/m1/s1 |
| InChIKey | SVFKZXOCPZNUMY-MPRYGIEUSA-N |
| XLogP | 6.77 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.70 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|