C21H31N7O2 — CID 167298573
(Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[5-(cyclopropylmethyl)-1,3,4-oxadiazol-2-yl]ethene-1,2-diamine (PubChem CID 167298573) has the molecular formula C21H31N7O2 and a molecular weight of 413.53 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[5-(cyclopropylmethyl)-1,3,4-oxadiazol-2-yl]ethene-1,2-diamine.
| Compound Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[5-(cyclopropylmethyl)-1,3,4-oxadiazol-2-yl]ethene-1,2-diamine |
|---|---|
| PubChem CID | 167298573 |
| Molecular Formula | C21H31N7O2 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[5-(cyclopropylmethyl)-1,3,4-oxadiazol-2-yl]ethene-1,2-diamine |
| SMILES | Cc1nc(/C(N)=C(\Nc2nnc(CC3CC3)o2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C21H31N7O2/c1-13-17(29-15-6-4-3-5-7-15)11-10-16(24-13)19(22)20(28(2)23)25-21-27-26-18(30-21)12-14-8-9-14/h10-11,14-15H,3-9,12,22-23H2,1-2H3,(H,25,27)/b20-19- |
| InChIKey | BSPSGTHOKJXMBF-VXPUYCOJSA-N |
| XLogP | 2.94 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|