C39H70O8 — CID 170375874
[1-[2-[(E)-dec-2-enoxy]-2-oxoethoxy]-13-[(E)-non-2-enoxy]carbonyloxytridecan-7-yl] butanoate (PubChem CID 170375874) has the molecular formula C39H70O8 and a molecular weight of 666.98 g/mol. Its IUPAC name is [1-[2-[(E)-dec-2-enoxy]-2-oxoethoxy]-13-[(E)-non-2-enoxy]carbonyloxytridecan-7-yl] butanoate.
| Compound Name | [1-[2-[(E)-dec-2-enoxy]-2-oxoethoxy]-13-[(E)-non-2-enoxy]carbonyloxytridecan-7-yl] butanoate |
|---|---|
| PubChem CID | 170375874 |
| Molecular Formula | C39H70O8 |
| Molecular Weight | 666.98 g/mol |
| Exact Mass | 666.51 |
| IUPAC Name | [1-[2-[(E)-dec-2-enoxy]-2-oxoethoxy]-13-[(E)-non-2-enoxy]carbonyloxytridecan-7-yl] butanoate |
| SMILES | CCCCCC/C=C/COC(=O)OCCCCCCC(CCCCCCOCC(=O)OC/C=C/CCCCCCC)OC(=O)CCC |
| InChI | InChI=1S/C39H70O8/c1-4-7-9-11-13-15-18-25-32-44-38(41)35-43-31-24-20-16-22-29-36(47-37(40)28-6-3)30-23-17-21-27-34-46-39(42)45-33-26-19-14-12-10-8-5-2/h18-19,25-26,36H,4-17,20-24,27-35H2,1-3H3/b25-18+,26-19+ |
| InChIKey | UCIRNXVYPVXYIN-XUWUHCBVSA-N |
| XLogP | 10.76 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.98 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|