About aminooxy(phenyl)borinic acid;9H-fluorene
aminooxy(phenyl)borinic acid;9H-fluorene (PubChem CID 174868194) has the molecular formula C19H18BNO2
and a molecular weight of 303.17 g/mol. Its IUPAC name is aminooxy(phenyl)borinic acid;9H-fluorene.
Molecular Properties
| Compound Name | aminooxy(phenyl)borinic acid;9H-fluorene |
| PubChem CID | 174868194 |
| Molecular Formula | C19H18BNO2 |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | aminooxy(phenyl)borinic acid;9H-fluorene |
| SMILES | NOB(O)c1ccccc1.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C6H8BNO2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;8-10-7(9)6-4-2-1-3-5-6/h1-8H,9H2;1-5,9H,8H2 |
| InChIKey | ASAUKFTZKSOCMS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze aminooxy(phenyl)borinic acid;9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminooxy(phenyl)borinic acid;9H-fluorene?
The IUPAC name of aminooxy(phenyl)borinic acid;9H-fluorene (CID 174868194) is aminooxy(phenyl)borinic acid;9H-fluorene.
What is the SMILES notation for aminooxy(phenyl)borinic acid;9H-fluorene?
The canonical SMILES for aminooxy(phenyl)borinic acid;9H-fluorene is NOB(O)c1ccccc1.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of aminooxy(phenyl)borinic acid;9H-fluorene?
The InChIKey is ASAUKFTZKSOCMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C6H8BNO2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;8-10-7(9)6-4-2-1-3-5-6/h1-8H,9H2;1-5,9H,8H2.
What are the key properties of aminooxy(phenyl)borinic acid;9H-fluorene?
aminooxy(phenyl)borinic acid;9H-fluorene has a molecular weight of 303.17 g/mol, XLogP of 2.52, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aminooxy(phenyl)borinic acid;9H-fluorene is sourced from PubChem (CID 174868194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).