About 2-[(2S)-1-methylpyrrolidin-2-yl]-1H-pyrrole;pyridine
2-[(2S)-1-methylpyrrolidin-2-yl]-1H-pyrrole;pyridine (PubChem CID 174932000) has the molecular formula C14H19N3
and a molecular weight of 229.33 g/mol. Its IUPAC name is 2-[(2S)-1-methylpyrrolidin-2-yl]-1H-pyrrole;pyridine.
Molecular Properties
| Compound Name | 2-[(2S)-1-methylpyrrolidin-2-yl]-1H-pyrrole;pyridine |
| PubChem CID | 174932000 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 2-[(2S)-1-methylpyrrolidin-2-yl]-1H-pyrrole;pyridine |
| SMILES | CN1CCC[C@H]1c1ccc[nH]1.c1ccncc1 |
| InChI | InChI=1S/C9H14N2.C5H5N/c1-11-7-3-5-9(11)8-4-2-6-10-8;1-2-4-6-5-3-1/h2,4,6,9-10H,3,5,7H2,1H3;1-5H/t9-;/m0./s1 |
| InChIKey | WERHJPSDIMJRRF-FVGYRXGTSA-N |
| XLogP | 2.86 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2S)-1-methylpyrrolidin-2-yl]-1H-pyrrole;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-1-methylpyrrolidin-2-yl]-1H-pyrrole;pyridine?
The IUPAC name of 2-[(2S)-1-methylpyrrolidin-2-yl]-1H-pyrrole;pyridine (CID 174932000) is 2-[(2S)-1-methylpyrrolidin-2-yl]-1H-pyrrole;pyridine.
What is the SMILES notation for 2-[(2S)-1-methylpyrrolidin-2-yl]-1H-pyrrole;pyridine?
The canonical SMILES for 2-[(2S)-1-methylpyrrolidin-2-yl]-1H-pyrrole;pyridine is CN1CCC[C@H]1c1ccc[nH]1.c1ccncc1.
What is the InChIKey of 2-[(2S)-1-methylpyrrolidin-2-yl]-1H-pyrrole;pyridine?
The InChIKey is WERHJPSDIMJRRF-FVGYRXGTSA-N. The full InChI is InChI=1S/C9H14N2.C5H5N/c1-11-7-3-5-9(11)8-4-2-6-10-8;1-2-4-6-5-3-1/h2,4,6,9-10H,3,5,7H2,1H3;1-5H/t9-;/m0./s1.
What are the key properties of 2-[(2S)-1-methylpyrrolidin-2-yl]-1H-pyrrole;pyridine?
2-[(2S)-1-methylpyrrolidin-2-yl]-1H-pyrrole;pyridine has a molecular weight of 229.33 g/mol, XLogP of 2.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-1-methylpyrrolidin-2-yl]-1H-pyrrole;pyridine is sourced from PubChem (CID 174932000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).