C11H7IrN2- — CID 175347393
1,9-dihydropyrido[3,4-b]indol-1-ide;iridium (PubChem CID 175347393) has the molecular formula C11H7IrN2- and a molecular weight of 359.41 g/mol. Its IUPAC name is 1,9-dihydropyrido[3,4-b]indol-1-ide;iridium.
| Compound Name | 1,9-dihydropyrido[3,4-b]indol-1-ide;iridium |
|---|---|
| PubChem CID | 175347393 |
| Molecular Formula | C11H7IrN2- |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 1,9-dihydropyrido[3,4-b]indol-1-ide;iridium |
| SMILES | [Ir].[c-]1nccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C11H7N2.Ir/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10;/h1-6,13H;/q-1; |
| InChIKey | DMFTUTJKSJXORQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|