C7H14N4OS — CID 175730846
2-[(4S)-4-amino-5-oxo-6-sulfanylidenehexyl]guanidine (PubChem CID 175730846) has the molecular formula C7H14N4OS and a molecular weight of 202.28 g/mol. Its IUPAC name is 2-[(4S)-4-amino-5-oxo-6-sulfanylidenehexyl]guanidine.
| Compound Name | 2-[(4S)-4-amino-5-oxo-6-sulfanylidenehexyl]guanidine |
|---|---|
| PubChem CID | 175730846 |
| Molecular Formula | C7H14N4OS |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 2-[(4S)-4-amino-5-oxo-6-sulfanylidenehexyl]guanidine |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)C=S |
| InChI | InChI=1S/C7H14N4OS/c8-5(6(12)4-13)2-1-3-11-7(9)10/h4-5H,1-3,8H2,(H4,9,10,11)/t5-/m0/s1 |
| InChIKey | NPEFJBYVFHPQGC-YFKPBYRVSA-N |
| XLogP | -1.06 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|