C19H21O3PSe — CID 175961690
2-ethoxy-5-(2-methylphenyl)selanyl-6-phenyl-3,4-dihydro-1,2λ5-oxaphosphinine 2-oxide (PubChem CID 175961690) has the molecular formula C19H21O3PSe and a molecular weight of 407.31 g/mol. Its IUPAC name is 2-ethoxy-5-(2-methylphenyl)selanyl-6-phenyl-3,4-dihydro-1,2λ5-oxaphosphinine 2-oxide.
| Compound Name | 2-ethoxy-5-(2-methylphenyl)selanyl-6-phenyl-3,4-dihydro-1,2λ5-oxaphosphinine 2-oxide |
|---|---|
| PubChem CID | 175961690 |
| Molecular Formula | C19H21O3PSe |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 2-ethoxy-5-(2-methylphenyl)selanyl-6-phenyl-3,4-dihydro-1,2λ5-oxaphosphinine 2-oxide |
| SMILES | CCOP1(=O)CCC([Se]c2ccccc2C)=C(c2ccccc2)O1 |
| InChI | InChI=1S/C19H21O3PSe/c1-3-21-23(20)14-13-18(24-17-12-8-7-9-15(17)2)19(22-23)16-10-5-4-6-11-16/h4-12H,3,13-14H2,1-2H3 |
| InChIKey | SYISAFFYTWWSHW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|