C12H17IO4 — CID 176847813
2-[(3-hydroxy-5-iodo-1-adamantyl)oxy]acetic acid (PubChem CID 176847813) has the molecular formula C12H17IO4 and a molecular weight of 352.17 g/mol. Its IUPAC name is 2-[(3-hydroxy-5-iodo-1-adamantyl)oxy]acetic acid.
| Compound Name | 2-[(3-hydroxy-5-iodo-1-adamantyl)oxy]acetic acid |
|---|---|
| PubChem CID | 176847813 |
| Molecular Formula | C12H17IO4 |
| Molecular Weight | 352.17 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 2-[(3-hydroxy-5-iodo-1-adamantyl)oxy]acetic acid |
| SMILES | O=C(O)COC12CC3CC(O)(CC(I)(C3)C1)C2 |
| InChI | InChI=1S/C12H17IO4/c13-10-1-8-2-11(16,5-10)7-12(3-8,6-10)17-4-9(14)15/h8,16H,1-7H2,(H,14,15) |
| InChIKey | ZNMCSIHOZLWYDP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.17 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|