C45H47N3O — CID 177242592
2,4-diphenyl-6-[2-(4,6,8-tritert-butyl-3,4-dihydrodibenzofuran-1-yl)phenyl]-1,3,5-triazine (PubChem CID 177242592) has the molecular formula C45H47N3O and a molecular weight of 645.89 g/mol. Its IUPAC name is 2,4-diphenyl-6-[2-(4,6,8-tritert-butyl-3,4-dihydrodibenzofuran-1-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[2-(4,6,8-tritert-butyl-3,4-dihydrodibenzofuran-1-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 177242592 |
| Molecular Formula | C45H47N3O |
| Molecular Weight | 645.89 g/mol |
| Exact Mass | 645.37 |
| IUPAC Name | 2,4-diphenyl-6-[2-(4,6,8-tritert-butyl-3,4-dihydrodibenzofuran-1-yl)phenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc3c(c2c1)C(c1ccccc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1)=CCC3C(C)(C)C |
| InChI | InChI=1S/C45H47N3O/c1-43(2,3)30-26-34-37-32(24-25-35(44(4,5)6)39(37)49-38(34)36(27-30)45(7,8)9)31-22-16-17-23-33(31)42-47-40(28-18-12-10-13-19-28)46-41(48-42)29-20-14-11-15-21-29/h10-24,26-27,35H,25H2,1-9H3 |
| InChIKey | AFYPBQVHZXXEAC-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.89 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |