C19H17ClN4O3S2 — CID 19586132
methyl 3-chloro-6-[[(E)-3-(1-ethylpyrazol-4-yl)prop-2-enoyl]carbamothioylamino]-1-benzothiophene-2-carboxylate (PubChem CID 19586132) has the molecular formula C19H17ClN4O3S2 and a molecular weight of 448.96 g/mol. Its IUPAC name is methyl 3-chloro-6-[[(E)-3-(1-ethylpyrazol-4-yl)prop-2-enoyl]carbamothioylamino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-chloro-6-[[(E)-3-(1-ethylpyrazol-4-yl)prop-2-enoyl]carbamothioylamino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19586132 |
| Molecular Formula | C19H17ClN4O3S2 |
| Molecular Weight | 448.96 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | methyl 3-chloro-6-[[(E)-3-(1-ethylpyrazol-4-yl)prop-2-enoyl]carbamothioylamino]-1-benzothiophene-2-carboxylate |
| SMILES | CCn1cc(/C=C/C(=O)NC(=S)Nc2ccc3c(Cl)c(C(=O)OC)sc3c2)cn1 |
| InChI | InChI=1S/C19H17ClN4O3S2/c1-3-24-10-11(9-21-24)4-7-15(25)23-19(28)22-12-5-6-13-14(8-12)29-17(16(13)20)18(26)27-2/h4-10H,3H2,1-2H3,(H2,22,23,25,28)/b7-4+ |
| InChIKey | UIPMCVHWHWRPJR-QPJJXVBHSA-N |
| XLogP | 4.08 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.96 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|