C37H44O6 — CID 21044882
[9-methyl-7-[[4-[3-(oxiran-2-yl)propyl]cyclohex-3-en-1-yl]methylperoxy]-9H-fluoren-2-yl] 4-[2-(oxiran-2-yl)ethyl]cyclohex-3-ene-1-carboxylate (PubChem CID 21044882) has the molecular formula C37H44O6 and a molecular weight of 584.75 g/mol. Its IUPAC name is [9-methyl-7-[[4-[3-(oxiran-2-yl)propyl]cyclohex-3-en-1-yl]methylperoxy]-9H-fluoren-2-yl] 4-[2-(oxiran-2-yl)ethyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | [9-methyl-7-[[4-[3-(oxiran-2-yl)propyl]cyclohex-3-en-1-yl]methylperoxy]-9H-fluoren-2-yl] 4-[2-(oxiran-2-yl)ethyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 21044882 |
| Molecular Formula | C37H44O6 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | [9-methyl-7-[[4-[3-(oxiran-2-yl)propyl]cyclohex-3-en-1-yl]methylperoxy]-9H-fluoren-2-yl] 4-[2-(oxiran-2-yl)ethyl]cyclohex-3-ene-1-carboxylate |
| SMILES | CC1c2cc(OOCC3CC=C(CCCC4CO4)CC3)ccc2-c2ccc(OC(=O)C3CC=C(CCC4CO4)CC3)cc21 |
| InChI | InChI=1S/C37H44O6/c1-24-35-19-29(42-37(38)28-12-9-26(10-13-28)11-14-32-23-40-32)15-17-33(35)34-18-16-30(20-36(24)34)43-41-21-27-7-5-25(6-8-27)3-2-4-31-22-39-31/h5,9,15-20,24,27-28,31-32H,2-4,6-8,10-14,21-23H2,1H3 |
| InChIKey | YGSRRYOOHQDSOL-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 69.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|