C33H41NO7SSi — CID 25139256
[[(3S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-3-yl]oxycarbonylamino] 2,4,6-trimethylbenzenesulfonate (PubChem CID 25139256) has the molecular formula C33H41NO7SSi and a molecular weight of 623.84 g/mol. Its IUPAC name is [[(3S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-3-yl]oxycarbonylamino] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [[(3S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-3-yl]oxycarbonylamino] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 25139256 |
| Molecular Formula | C33H41NO7SSi |
| Molecular Weight | 623.84 g/mol |
| Exact Mass | 623.24 |
| IUPAC Name | [[(3S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-3-yl]oxycarbonylamino] 2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)ONC(=O)O[C@H]2C=C[C@H](CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)OC2)c(C)c1 |
| InChI | InChI=1S/C33H41NO7SSi/c1-24-21-25(2)31(26(3)22-24)42(36,37)41-34-32(35)40-28-18-17-27(38-23-28)19-20-39-43(33(4,5)6,29-13-9-7-10-14-29)30-15-11-8-12-16-30/h7-18,21-22,27-28H,19-20,23H2,1-6H3,(H,34,35)/t27-,28+/m1/s1 |
| InChIKey | SFVWKUAQVAULMW-IZLXSDGUSA-N |
| XLogP | 5.25 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.84 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|