About 3-tritiooxyphenol
3-tritiooxyphenol (PubChem CID 118553198) has the molecular formula C6H6O2
and a molecular weight of 112.12 g/mol. Its IUPAC name is 3-tritiooxyphenol.
Molecular Properties
| Compound Name | 3-tritiooxyphenol |
| PubChem CID | 118553198 |
| Molecular Formula | C6H6O2 |
| Molecular Weight | 112.12 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | 3-tritiooxyphenol |
| SMILES | [3H]Oc1cccc(O)c1 |
| InChI | InChI=1S/C6H6O2/c7-5-2-1-3-6(8)4-5/h1-4,7-8H/i/hT |
| InChIKey | GHMLBKRAJCXXBS-MNYXATJNSA-N |
| XLogP | 1.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.12 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tritiooxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tritiooxyphenol?
The IUPAC name of 3-tritiooxyphenol (CID 118553198) is 3-tritiooxyphenol.
What is the SMILES notation for 3-tritiooxyphenol?
The canonical SMILES for 3-tritiooxyphenol is [3H]Oc1cccc(O)c1.
What is the InChIKey of 3-tritiooxyphenol?
The InChIKey is GHMLBKRAJCXXBS-MNYXATJNSA-N. The full InChI is InChI=1S/C6H6O2/c7-5-2-1-3-6(8)4-5/h1-4,7-8H/i/hT.
What are the key properties of 3-tritiooxyphenol?
3-tritiooxyphenol has a molecular weight of 112.12 g/mol, XLogP of 1.10, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tritiooxyphenol is sourced from PubChem (CID 118553198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).