C9H18ClN3O2 — CID 53394744
chloro 2-amino-5-(1-aminobutylideneamino)pentanoate (PubChem CID 53394744) has the molecular formula C9H18ClN3O2 and a molecular weight of 235.71 g/mol. Its IUPAC name is chloro 2-amino-5-(1-aminobutylideneamino)pentanoate.
| Compound Name | chloro 2-amino-5-(1-aminobutylideneamino)pentanoate |
|---|---|
| PubChem CID | 53394744 |
| Molecular Formula | C9H18ClN3O2 |
| Molecular Weight | 235.71 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | chloro 2-amino-5-(1-aminobutylideneamino)pentanoate |
| SMILES | CCC/C(N)=N\CCCC(N)C(=O)OCl |
| InChI | InChI=1S/C9H18ClN3O2/c1-2-4-8(12)13-6-3-5-7(11)9(14)15-10/h7H,2-6,11H2,1H3,(H2,12,13) |
| InChIKey | HICULVOPJMRQHX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.71 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|