C32H36N2Si — CID 58634752
[(7aR)-2,2-dimethyl-4-(2-phenylethynyl)-3a,7a-dihydro-3H-benzimidazol-1-yl]-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-dimethylsilane (PubChem CID 58634752) has the molecular formula C32H36N2Si and a molecular weight of 476.74 g/mol. Its IUPAC name is [(7aR)-2,2-dimethyl-4-(2-phenylethynyl)-3a,7a-dihydro-3H-benzimidazol-1-yl]-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-dimethylsilane.
| Compound Name | [(7aR)-2,2-dimethyl-4-(2-phenylethynyl)-3a,7a-dihydro-3H-benzimidazol-1-yl]-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-dimethylsilane |
|---|---|
| PubChem CID | 58634752 |
| Molecular Formula | C32H36N2Si |
| Molecular Weight | 476.74 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | [(7aR)-2,2-dimethyl-4-(2-phenylethynyl)-3a,7a-dihydro-3H-benzimidazol-1-yl]-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-dimethylsilane |
| SMILES | CC1(C)NC2C(C#Cc3ccccc3)=CC=C[C@H]2N1[Si](C)(C)C1C2C=CC=CC2C2C=CC=CC21 |
| InChI | InChI=1S/C32H36N2Si/c1-32(2)33-30-24(22-21-23-13-6-5-7-14-23)15-12-20-29(30)34(32)35(3,4)31-27-18-10-8-16-25(27)26-17-9-11-19-28(26)31/h5-20,25-31,33H,1-4H3/t25?,26?,27?,28?,29-,30?,31?/m1/s1 |
| InChIKey | AIQMFCFDJITOPJ-RIASFIFBSA-N |
| XLogP | 6.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.74 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|