C23H27F3N4OS2 — CID 58792013
4-(2-methoxypyrimidin-5-yl)-N-[4-octylsulfanyl-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine (PubChem CID 58792013) has the molecular formula C23H27F3N4OS2 and a molecular weight of 496.62 g/mol. Its IUPAC name is 4-(2-methoxypyrimidin-5-yl)-N-[4-octylsulfanyl-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-(2-methoxypyrimidin-5-yl)-N-[4-octylsulfanyl-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58792013 |
| Molecular Formula | C23H27F3N4OS2 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 4-(2-methoxypyrimidin-5-yl)-N-[4-octylsulfanyl-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
| SMILES | CCCCCCCCSc1ccc(Nc2nc(-c3cnc(OC)nc3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H27F3N4OS2/c1-3-4-5-6-7-8-11-32-20-10-9-17(12-18(20)23(24,25)26)29-22-30-19(15-33-22)16-13-27-21(31-2)28-14-16/h9-10,12-15H,3-8,11H2,1-2H3,(H,29,30) |
| InChIKey | SRSITCSUDNKYNZ-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|