C32H33ClN4O7 — CID 59176067
[4-[[5-[[5-chloropentyl(phenylmethoxycarbonyl)amino]methyl]-1,3-benzodioxol-4-yl]amino]-7-methoxyquinazolin-6-yl] acetate (PubChem CID 59176067) has the molecular formula C32H33ClN4O7 and a molecular weight of 621.09 g/mol. Its IUPAC name is [4-[[5-[[5-chloropentyl(phenylmethoxycarbonyl)amino]methyl]-1,3-benzodioxol-4-yl]amino]-7-methoxyquinazolin-6-yl] acetate.
| Compound Name | [4-[[5-[[5-chloropentyl(phenylmethoxycarbonyl)amino]methyl]-1,3-benzodioxol-4-yl]amino]-7-methoxyquinazolin-6-yl] acetate |
|---|---|
| PubChem CID | 59176067 |
| Molecular Formula | C32H33ClN4O7 |
| Molecular Weight | 621.09 g/mol |
| Exact Mass | 620.20 |
| IUPAC Name | [4-[[5-[[5-chloropentyl(phenylmethoxycarbonyl)amino]methyl]-1,3-benzodioxol-4-yl]amino]-7-methoxyquinazolin-6-yl] acetate |
| SMILES | COc1cc2ncnc(Nc3c(CN(CCCCCCl)C(=O)OCc4ccccc4)ccc4c3OCO4)c2cc1OC(C)=O |
| InChI | InChI=1S/C32H33ClN4O7/c1-21(38)44-28-15-24-25(16-27(28)40-2)34-19-35-31(24)36-29-23(11-12-26-30(29)43-20-42-26)17-37(14-8-4-7-13-33)32(39)41-18-22-9-5-3-6-10-22/h3,5-6,9-12,15-16,19H,4,7-8,13-14,17-18,20H2,1-2H3,(H,34,35,36) |
| InChIKey | NQRCOXIRYJQDEL-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.09 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|