C20H28F3NO5S — CID 59801413
[(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylidene]amino] cyclohexanesulfonate (PubChem CID 59801413) has the molecular formula C20H28F3NO5S and a molecular weight of 451.51 g/mol. Its IUPAC name is [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylidene]amino] cyclohexanesulfonate.
| Compound Name | [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylidene]amino] cyclohexanesulfonate |
|---|---|
| PubChem CID | 59801413 |
| Molecular Formula | C20H28F3NO5S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylidene]amino] cyclohexanesulfonate |
| SMILES | CCC(C)(C)C(OO)c1ccc(/C(=N\OS(=O)(=O)C2CCCCC2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H28F3NO5S/c1-4-19(2,3)18(28-25)15-12-10-14(11-13-15)17(20(21,22)23)24-29-30(26,27)16-8-6-5-7-9-16/h10-13,16,18,25H,4-9H2,1-3H3/b24-17+ |
| InChIKey | KIBSWVQCBVLBKS-JJIBRWJFSA-N |
| XLogP | 5.60 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|