C28H38F3NO5S — CID 72565719
[[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylidene]amino] 2,4,6-tri(propan-2-yl)benzenesulfonate (PubChem CID 72565719) has the molecular formula C28H38F3NO5S and a molecular weight of 557.68 g/mol. Its IUPAC name is [[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylidene]amino] 2,4,6-tri(propan-2-yl)benzenesulfonate.
| Compound Name | [[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylidene]amino] 2,4,6-tri(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 72565719 |
| Molecular Formula | C28H38F3NO5S |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | [[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylidene]amino] 2,4,6-tri(propan-2-yl)benzenesulfonate |
| SMILES | CCC(C)C(OO)c1ccc(C(=NOS(=O)(=O)c2c(C(C)C)cc(C(C)C)cc2C(C)C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H38F3NO5S/c1-9-19(8)25(36-33)20-10-12-21(13-11-20)27(28(29,30)31)32-37-38(34,35)26-23(17(4)5)14-22(16(2)3)15-24(26)18(6)7/h10-19,25,33H,9H2,1-8H3 |
| InChIKey | PLRMCPKZLKXUAW-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|