C15H21N5 — CID 66016187
3-ethyl-1-methyl-5-(2-pyridin-3-ylpyrrolidin-1-yl)pyrazol-4-amine (PubChem CID 66016187) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 3-ethyl-1-methyl-5-(2-pyridin-3-ylpyrrolidin-1-yl)pyrazol-4-amine.
| Compound Name | 3-ethyl-1-methyl-5-(2-pyridin-3-ylpyrrolidin-1-yl)pyrazol-4-amine |
|---|---|
| PubChem CID | 66016187 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 3-ethyl-1-methyl-5-(2-pyridin-3-ylpyrrolidin-1-yl)pyrazol-4-amine |
| SMILES | CCc1nn(C)c(N2CCCC2c2cccnc2)c1N |
| InChI | InChI=1S/C15H21N5/c1-3-12-14(16)15(19(2)18-12)20-9-5-7-13(20)11-6-4-8-17-10-11/h4,6,8,10,13H,3,5,7,9,16H2,1-2H3 |
| InChIKey | UPNZSUIAXAXQLQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |