About aminophosphonous acid;diphenylmethanone
aminophosphonous acid;diphenylmethanone (PubChem CID 70010429) has the molecular formula C13H14NO3P
and a molecular weight of 263.23 g/mol. Its IUPAC name is aminophosphonous acid;diphenylmethanone.
Molecular Properties
| Compound Name | aminophosphonous acid;diphenylmethanone |
| PubChem CID | 70010429 |
| Molecular Formula | C13H14NO3P |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | aminophosphonous acid;diphenylmethanone |
| SMILES | NP(O)O.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.H4NO2P/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-4(2)3/h1-10H;2-3H,1H2 |
| InChIKey | BCPZEJBDBBBBSH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze aminophosphonous acid;diphenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminophosphonous acid;diphenylmethanone?
The IUPAC name of aminophosphonous acid;diphenylmethanone (CID 70010429) is aminophosphonous acid;diphenylmethanone.
What is the SMILES notation for aminophosphonous acid;diphenylmethanone?
The canonical SMILES for aminophosphonous acid;diphenylmethanone is NP(O)O.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of aminophosphonous acid;diphenylmethanone?
The InChIKey is BCPZEJBDBBBBSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.H4NO2P/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-4(2)3/h1-10H;2-3H,1H2.
What are the key properties of aminophosphonous acid;diphenylmethanone?
aminophosphonous acid;diphenylmethanone has a molecular weight of 263.23 g/mol, XLogP of 2.07, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aminophosphonous acid;diphenylmethanone is sourced from PubChem (CID 70010429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).