C20H20FN5O3S — CID 71228245
2-[4-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]-4,5-dihydroimidazol-1-yl]-N,N-dimethylethanamine (PubChem CID 71228245) has the molecular formula C20H20FN5O3S and a molecular weight of 429.48 g/mol. Its IUPAC name is 2-[4-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]-4,5-dihydroimidazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]-4,5-dihydroimidazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 71228245 |
| Molecular Formula | C20H20FN5O3S |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 2-[4-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]-4,5-dihydroimidazol-1-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCN1C=NC(c2cc3nccc(Oc4ccc([N+](=O)[O-])cc4F)c3s2)C1 |
| InChI | InChI=1S/C20H20FN5O3S/c1-24(2)7-8-25-11-16(23-12-25)19-10-15-20(30-19)18(5-6-22-15)29-17-4-3-13(26(27)28)9-14(17)21/h3-6,9-10,12,16H,7-8,11H2,1-2H3 |
| InChIKey | KJIWUBHGIMBLHI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 84.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|