C21H29NO6 — CID 73207834
11-hydroxy-3,8-dimethyl-12-(4-methylpiperidin-1-yl)-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-ene-4,14-dione (PubChem CID 73207834) has the molecular formula C21H29NO6 and a molecular weight of 391.46 g/mol. Its IUPAC name is 11-hydroxy-3,8-dimethyl-12-(4-methylpiperidin-1-yl)-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-ene-4,14-dione.
| Compound Name | 11-hydroxy-3,8-dimethyl-12-(4-methylpiperidin-1-yl)-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-ene-4,14-dione |
|---|---|
| PubChem CID | 73207834 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 11-hydroxy-3,8-dimethyl-12-(4-methylpiperidin-1-yl)-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-ene-4,14-dione |
| SMILES | CC1CCN(C2C3=CC(OC3=O)C3C(CC4(C)OC4C2O)OC(=O)C3C)CC1 |
| InChI | InChI=1S/C21H29NO6/c1-10-4-6-22(7-5-10)16-12-8-13(26-20(12)25)15-11(2)19(24)27-14(15)9-21(3)18(28-21)17(16)23/h8,10-11,13-18,23H,4-7,9H2,1-3H3 |
| InChIKey | FLZJYNURWQWBNH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|