C26H28N2O7S — CID 87924946
1-benzothiophen-3-yl-[12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl]carbamic acid (PubChem CID 87924946) has the molecular formula C26H28N2O7S and a molecular weight of 512.58 g/mol. Its IUPAC name is 1-benzothiophen-3-yl-[12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl]carbamic acid.
| Compound Name | 1-benzothiophen-3-yl-[12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl]carbamic acid |
|---|---|
| PubChem CID | 87924946 |
| Molecular Formula | C26H28N2O7S |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 1-benzothiophen-3-yl-[12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl]carbamic acid |
| SMILES | CC1C(=O)OC2CC3(C)OC3C(N(C(=O)O)c3csc4ccccc34)C(N(C)C)C3=CC(OC3=O)C21 |
| InChI | InChI=1S/C26H28N2O7S/c1-12-19-16-9-14(24(30)33-16)20(27(3)4)21(22-26(2,35-22)10-17(19)34-23(12)29)28(25(31)32)15-11-36-18-8-6-5-7-13(15)18/h5-9,11-12,16-17,19-22H,10H2,1-4H3,(H,31,32) |
| InChIKey | PHHZFXJAXBEHQF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|