C8H10N2S — CID 83815940
1,2,3,4-tetrahydropyrido[3,4-b][1,4]thiazepine (PubChem CID 83815940) has the molecular formula C8H10N2S and a molecular weight of 166.25 g/mol. Its IUPAC name is 1,2,3,4-tetrahydropyrido[3,4-b][1,4]thiazepine.
| Compound Name | 1,2,3,4-tetrahydropyrido[3,4-b][1,4]thiazepine |
|---|---|
| PubChem CID | 83815940 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 1,2,3,4-tetrahydropyrido[3,4-b][1,4]thiazepine |
| SMILES | c1cc2c(cn1)SCCCN2 |
| InChI | InChI=1S/C8H10N2S/c1-3-10-7-2-4-9-6-8(7)11-5-1/h2,4,6,10H,1,3,5H2 |
| InChIKey | VIULLHYHVDVNRH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |