C19H41N7O3 — CID 87120374
N-[4-(3-aminopropylamino)butyl]-N'-[8-(hydrazinylmethylideneamino)octyl]-2-hydroxypropanediamide (PubChem CID 87120374) has the molecular formula C19H41N7O3 and a molecular weight of 415.58 g/mol. Its IUPAC name is N-[4-(3-aminopropylamino)butyl]-N'-[8-(hydrazinylmethylideneamino)octyl]-2-hydroxypropanediamide.
| Compound Name | N-[4-(3-aminopropylamino)butyl]-N'-[8-(hydrazinylmethylideneamino)octyl]-2-hydroxypropanediamide |
|---|---|
| PubChem CID | 87120374 |
| Molecular Formula | C19H41N7O3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.33 |
| IUPAC Name | N-[4-(3-aminopropylamino)butyl]-N'-[8-(hydrazinylmethylideneamino)octyl]-2-hydroxypropanediamide |
| SMILES | NCCCNCCCCNC(=O)C(O)C(=O)NCCCCCCCC/N=C/NN |
| InChI | InChI=1S/C19H41N7O3/c20-10-9-13-22-11-7-8-15-25-19(29)17(27)18(28)24-14-6-4-2-1-3-5-12-23-16-26-21/h16-17,22,27H,1-15,20-21H2,(H,23,26)(H,24,28)(H,25,29) |
| InChIKey | QWNAOANZLUHNKS-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 166.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|