C9H19N3O4S3 — CID 87534171
(2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;1,3-thiazolidine (PubChem CID 87534171) has the molecular formula C9H19N3O4S3 and a molecular weight of 329.47 g/mol. Its IUPAC name is (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;1,3-thiazolidine.
| Compound Name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;1,3-thiazolidine |
|---|---|
| PubChem CID | 87534171 |
| Molecular Formula | C9H19N3O4S3 |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;1,3-thiazolidine |
| SMILES | C1CSCN1.N[C@@H](CSSC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H12N2O4S2.C3H7NS/c7-3(5(9)10)1-13-14-2-4(8)6(11)12;1-2-5-3-4-1/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12);4H,1-3H2/t3-,4-;/m0./s1 |
| InChIKey | BAUXHHMZEZDFKY-MMALYQPHSA-N |
| XLogP | -0.53 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|