C21H29NO5Si — CID 87783033
7-[tert-butyl(dimethyl)silyl]oxy-7a-(phenylmethoxyamino)-4,7-dihydro-3H-cyclopenta[b]pyran-2,6-dione (PubChem CID 87783033) has the molecular formula C21H29NO5Si and a molecular weight of 403.55 g/mol. Its IUPAC name is 7-[tert-butyl(dimethyl)silyl]oxy-7a-(phenylmethoxyamino)-4,7-dihydro-3H-cyclopenta[b]pyran-2,6-dione.
| Compound Name | 7-[tert-butyl(dimethyl)silyl]oxy-7a-(phenylmethoxyamino)-4,7-dihydro-3H-cyclopenta[b]pyran-2,6-dione |
|---|---|
| PubChem CID | 87783033 |
| Molecular Formula | C21H29NO5Si |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 7-[tert-butyl(dimethyl)silyl]oxy-7a-(phenylmethoxyamino)-4,7-dihydro-3H-cyclopenta[b]pyran-2,6-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC1C(=O)C=C2CCC(=O)OC21NOCc1ccccc1 |
| InChI | InChI=1S/C21H29NO5Si/c1-20(2,3)28(4,5)27-19-17(23)13-16-11-12-18(24)26-21(16,19)22-25-14-15-9-7-6-8-10-15/h6-10,13,19,22H,11-12,14H2,1-5H3 |
| InChIKey | SOUDZNWQZLZXKU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|