C21H16BrN3O4 — CID 90487329
methyl 16-bromo-10,12-dioxo-11-phenyl-9,11,13-triazatetracyclo[6.5.2.12,7.09,13]hexadeca-2,4,6,14-tetraene-16-carboxylate (PubChem CID 90487329) has the molecular formula C21H16BrN3O4 and a molecular weight of 454.28 g/mol. Its IUPAC name is methyl 16-bromo-10,12-dioxo-11-phenyl-9,11,13-triazatetracyclo[6.5.2.12,7.09,13]hexadeca-2,4,6,14-tetraene-16-carboxylate.
| Compound Name | methyl 16-bromo-10,12-dioxo-11-phenyl-9,11,13-triazatetracyclo[6.5.2.12,7.09,13]hexadeca-2,4,6,14-tetraene-16-carboxylate |
|---|---|
| PubChem CID | 90487329 |
| Molecular Formula | C21H16BrN3O4 |
| Molecular Weight | 454.28 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | methyl 16-bromo-10,12-dioxo-11-phenyl-9,11,13-triazatetracyclo[6.5.2.12,7.09,13]hexadeca-2,4,6,14-tetraene-16-carboxylate |
| SMILES | COC(=O)C1(Br)C2=CC=CC=C1C1C=CC2n2c(=O)n(-c3ccccc3)c(=O)n21 |
| InChI | InChI=1S/C21H16BrN3O4/c1-29-18(26)21(22)14-9-5-6-10-15(21)17-12-11-16(14)24-19(27)23(20(28)25(17)24)13-7-3-2-4-8-13/h2-12,16-17H,1H3 |
| InChIKey | OUOPOONLCFPQQU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|