C17H24N6O3 — CID 91090165
7-but-2-ynyl-1-(2-ethoxyethyl)-8-piperazin-1-yl-3H-purine-2,6-dione (PubChem CID 91090165) has the molecular formula C17H24N6O3 and a molecular weight of 360.42 g/mol. Its IUPAC name is 7-but-2-ynyl-1-(2-ethoxyethyl)-8-piperazin-1-yl-3H-purine-2,6-dione.
| Compound Name | 7-but-2-ynyl-1-(2-ethoxyethyl)-8-piperazin-1-yl-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 91090165 |
| Molecular Formula | C17H24N6O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 7-but-2-ynyl-1-(2-ethoxyethyl)-8-piperazin-1-yl-3H-purine-2,6-dione |
| SMILES | CC#CCn1c(N2CCNCC2)nc2[nH]c(=O)n(CCOCC)c(=O)c21 |
| InChI | InChI=1S/C17H24N6O3/c1-3-5-8-22-13-14(19-16(22)21-9-6-18-7-10-21)20-17(25)23(15(13)24)11-12-26-4-2/h18H,4,6-12H2,1-2H3,(H,20,25) |
| InChIKey | HFGUJHKAMLBREJ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|