C11H22OS — CID 101362024
2-[(E)-2,6-dimethylhept-1-enyl]sulfanylethanol (PubChem CID 101362024) has the molecular formula C11H22OS and a molecular weight of 202.36 g/mol. Its IUPAC name is 2-[(E)-2,6-dimethylhept-1-enyl]sulfanylethanol.
| Compound Name | 2-[(E)-2,6-dimethylhept-1-enyl]sulfanylethanol |
|---|---|
| PubChem CID | 101362024 |
| Molecular Formula | C11H22OS |
| Molecular Weight | 202.36 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2-[(E)-2,6-dimethylhept-1-enyl]sulfanylethanol |
| SMILES | C/C(=C\SCCO)CCCC(C)C |
| InChI | InChI=1S/C11H22OS/c1-10(2)5-4-6-11(3)9-13-8-7-12/h9-10,12H,4-8H2,1-3H3/b11-9+ |
| InChIKey | KLKUNDVYSYVDFN-PKNBQFBNSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|