C36H54O3SSi2 — CID 11146565
tert-butyl-[(2R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]heptan-2-yl]oxy-diphenylsilane (PubChem CID 11146565) has the molecular formula C36H54O3SSi2 and a molecular weight of 623.06 g/mol. Its IUPAC name is tert-butyl-[(2R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]heptan-2-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]heptan-2-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 11146565 |
| Molecular Formula | C36H54O3SSi2 |
| Molecular Weight | 623.06 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | tert-butyl-[(2R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]heptan-2-yl]oxy-diphenylsilane |
| SMILES | Cc1ccc([S@](=O)C[C@@H](CCC[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C36H54O3SSi2/c1-29-24-26-32(27-25-29)40(37)28-31(19-17-18-30(2)38-41(9,10)35(3,4)5)39-42(36(6,7)8,33-20-13-11-14-21-33)34-22-15-12-16-23-34/h11-16,20-27,30-31H,17-19,28H2,1-10H3/t30-,31+,40+/m0/s1 |
| InChIKey | FYUQJQDEKFRCLF-HYXMALDRSA-N |
| XLogP | 8.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.06 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|