C20H16Cl2F6N3+ — CID 123245795
aminomethylidene-[[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)phenyl]iminomethyl]-methylazanium (PubChem CID 123245795) has the molecular formula C20H16Cl2F6N3+ and a molecular weight of 483.26 g/mol. Its IUPAC name is aminomethylidene-[[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)phenyl]iminomethyl]-methylazanium.
| Compound Name | aminomethylidene-[[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)phenyl]iminomethyl]-methylazanium |
|---|---|
| PubChem CID | 123245795 |
| Molecular Formula | C20H16Cl2F6N3+ |
| Molecular Weight | 483.26 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | aminomethylidene-[[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)phenyl]iminomethyl]-methylazanium |
| SMILES | C[N+](/C=N/c1ccc(C=CC(c2cc(Cl)cc(Cl)c2)C(F)(F)F)cc1C(F)(F)F)=C\N |
| InChI | InChI=1S/C20H15Cl2F6N3/c1-31(10-29)11-30-18-5-3-12(6-17(18)20(26,27)28)2-4-16(19(23,24)25)13-7-14(21)9-15(22)8-13/h2-11,16,29H,1H3/p+1/b4-2?,30-11+ |
| InChIKey | MMFCEWFGMJNFNP-UIDQFNNOSA-O |
| XLogP | 6.66 |
| TPSA | 41.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.26 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|