C18H23O8P — CID 129130461
[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxycyclohexa-1,5-dien-1-yl)ethenyl]phenyl] dihydrogen phosphate (PubChem CID 129130461) has the molecular formula C18H23O8P and a molecular weight of 398.35 g/mol. Its IUPAC name is [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxycyclohexa-1,5-dien-1-yl)ethenyl]phenyl] dihydrogen phosphate.
| Compound Name | [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxycyclohexa-1,5-dien-1-yl)ethenyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 129130461 |
| Molecular Formula | C18H23O8P |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxycyclohexa-1,5-dien-1-yl)ethenyl]phenyl] dihydrogen phosphate |
| SMILES | COC1=CC(/C=C\c2ccc(OC)c(OP(=O)(O)O)c2)=CC(OC)C1OC |
| InChI | InChI=1S/C18H23O8P/c1-22-14-8-7-12(9-15(14)26-27(19,20)21)5-6-13-10-16(23-2)18(25-4)17(11-13)24-3/h5-11,16,18H,1-4H3,(H2,19,20,21)/b6-5- |
| InChIKey | FDKOJXJVLFIDCT-WAYWQWQTSA-N |
| XLogP | 2.68 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|