C9H11NO3 — CID 138986902
(2R)-2-(dideuterioamino)-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 138986902) has the molecular formula C9H11NO3 and a molecular weight of 183.20 g/mol. Its IUPAC name is (2R)-2-(dideuterioamino)-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2R)-2-(dideuterioamino)-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 138986902 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (2R)-2-(dideuterioamino)-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | [2H]N([2H])[C@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m1/s1/i/hD2 |
| InChIKey | OUYCCCASQSFEME-CHQMPMPUSA-N |
| XLogP | 0.35 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |