C10H3N4- — CID 140889252
(2-cyano-3,4-diisocyano-5-methylcyclopenta-2,4-dien-1-ylidene)methylideneazanide (PubChem CID 140889252) has the molecular formula C10H3N4- and a molecular weight of 179.16 g/mol. Its IUPAC name is (2-cyano-3,4-diisocyano-5-methylcyclopenta-2,4-dien-1-ylidene)methylideneazanide.
| Compound Name | (2-cyano-3,4-diisocyano-5-methylcyclopenta-2,4-dien-1-ylidene)methylideneazanide |
|---|---|
| PubChem CID | 140889252 |
| Molecular Formula | C10H3N4- |
| Molecular Weight | 179.16 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | (2-cyano-3,4-diisocyano-5-methylcyclopenta-2,4-dien-1-ylidene)methylideneazanide |
| SMILES | [C-]#[N+]C1=C(C)C(=C=[N-])C(C#N)=C1[N+]#[C-] |
| InChI | InChI=1S/C10H3N4/c1-6-7(4-11)8(5-12)10(14-3)9(6)13-2/h1H3/q-1 |
| InChIKey | JXRNFPVTAZYIBG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 54.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.16 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|