C25H26N6O4 — CID 144681772
(Z)-[amino-[7-[(4-ethynylcyclohexyl)methyl]-6-(3-methoxycarbonyl-5-methylphenyl)purin-2-yl]methylidene]carbamic acid (PubChem CID 144681772) has the molecular formula C25H26N6O4 and a molecular weight of 474.52 g/mol. Its IUPAC name is (Z)-[amino-[7-[(4-ethynylcyclohexyl)methyl]-6-(3-methoxycarbonyl-5-methylphenyl)purin-2-yl]methylidene]carbamic acid.
| Compound Name | (Z)-[amino-[7-[(4-ethynylcyclohexyl)methyl]-6-(3-methoxycarbonyl-5-methylphenyl)purin-2-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 144681772 |
| Molecular Formula | C25H26N6O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | (Z)-[amino-[7-[(4-ethynylcyclohexyl)methyl]-6-(3-methoxycarbonyl-5-methylphenyl)purin-2-yl]methylidene]carbamic acid |
| SMILES | C#CC1CCC(Cn2cnc3nc(/C(N)=N/C(=O)O)nc(-c4cc(C)cc(C(=O)OC)c4)c32)CC1 |
| InChI | InChI=1S/C25H26N6O4/c1-4-15-5-7-16(8-6-15)12-31-13-27-22-20(31)19(28-23(30-22)21(26)29-25(33)34)17-9-14(2)10-18(11-17)24(32)35-3/h1,9-11,13,15-16H,5-8,12H2,2-3H3,(H2,26,29)(H,33,34) |
| InChIKey | PTJBHWRIQIZPAM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|