C20H25N3 — CID 145283888
2-methyl-4-(1-methylcyclohexa-2,4-dien-1-yl)-6-[(3E,5Z)-2-methylocta-1,3,5-trien-3-yl]-1,3,5-triazine (PubChem CID 145283888) has the molecular formula C20H25N3 and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-methyl-4-(1-methylcyclohexa-2,4-dien-1-yl)-6-[(3E,5Z)-2-methylocta-1,3,5-trien-3-yl]-1,3,5-triazine.
| Compound Name | 2-methyl-4-(1-methylcyclohexa-2,4-dien-1-yl)-6-[(3E,5Z)-2-methylocta-1,3,5-trien-3-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 145283888 |
| Molecular Formula | C20H25N3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 2-methyl-4-(1-methylcyclohexa-2,4-dien-1-yl)-6-[(3E,5Z)-2-methylocta-1,3,5-trien-3-yl]-1,3,5-triazine |
| SMILES | C=C(C)/C(=C\C=C/CC)c1nc(C)nc(C2(C)C=CC=CC2)n1 |
| InChI | InChI=1S/C20H25N3/c1-6-7-9-12-17(15(2)3)18-21-16(4)22-19(23-18)20(5)13-10-8-11-14-20/h7-13H,2,6,14H2,1,3-5H3/b9-7-,17-12+ |
| InChIKey | RYQBDTQXQBXMEO-RZYRPPGSSA-N |
| XLogP | 4.88 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|