C13H5F13O5S — CID 58764495
1-(5-acetylthiophen-2-yl)-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethanone (PubChem CID 58764495) has the molecular formula C13H5F13O5S and a molecular weight of 520.22 g/mol. Its IUPAC name is 1-(5-acetylthiophen-2-yl)-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethanone.
| Compound Name | 1-(5-acetylthiophen-2-yl)-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethanone |
|---|---|
| PubChem CID | 58764495 |
| Molecular Formula | C13H5F13O5S |
| Molecular Weight | 520.22 g/mol |
| Exact Mass | 519.97 |
| IUPAC Name | 1-(5-acetylthiophen-2-yl)-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethanone |
| SMILES | CC(=O)c1ccc(C(=O)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F)s1 |
| InChI | InChI=1S/C13H5F13O5S/c1-4(27)5-2-3-6(32-5)7(28)8(14,15)29-9(16,17)10(18,19)30-11(20,21)12(22,23)31-13(24,25)26/h2-3H,1H3 |
| InChIKey | HBZAJUUIFRDFJG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.22 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|