C5H5N3O2 — CID 71342347
3-diazopiperidine-2,6-dione (PubChem CID 71342347) has the molecular formula C5H5N3O2 and a molecular weight of 139.11 g/mol. Its IUPAC name is 3-diazopiperidine-2,6-dione.
| Compound Name | 3-diazopiperidine-2,6-dione |
|---|---|
| PubChem CID | 71342347 |
| Molecular Formula | C5H5N3O2 |
| Molecular Weight | 139.11 g/mol |
| Exact Mass | 139.04 |
| IUPAC Name | 3-diazopiperidine-2,6-dione |
| SMILES | [N-]=[N+]=C1CCC(=O)NC1=O |
| InChI | InChI=1S/C5H5N3O2/c6-8-3-1-2-4(9)7-5(3)10/h1-2H2,(H,7,9,10) |
| InChIKey | AXPZVMOYJPRJAD-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.11 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|